C15H21N3O2 — CID 124754580
(1S)-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 124754580) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1S)-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 124754580 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (1S)-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1cc(C)n(CCNC(=O)[C@@H]2CC=CCC2)c(=O)n1 |
| InChI | InChI=1S/C15H21N3O2/c1-11-10-12(2)18(15(20)17-11)9-8-16-14(19)13-6-4-3-5-7-13/h3-4,10,13H,5-9H2,1-2H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | OJBQDBOMHHUAGT-CYBMUJFWSA-N |
| XLogP | 1.33 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|