C12H16N2O3S — CID 51984111
(1S)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 51984111) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is (1S)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 51984111 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (1S)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C12H16N2O3S/c15-10-8-18-12(17)14(10)7-6-13-11(16)9-4-2-1-3-5-9/h1-2,9H,3-8H2,(H,13,16)/t9-/m1/s1 |
| InChIKey | ZEPLKZLRBCNUGG-SECBINFHSA-N |
| XLogP | 1.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|