C16H18F2N2O2 — CID 95624826
N-[2-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]ethyl]-2,6-difluorobenzamide (PubChem CID 95624826) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[2-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]ethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 95624826 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-[2-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]ethyl]-2,6-difluorobenzamide |
| SMILES | O=C(NCCNC(=O)[C@@H]1CC=CCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H18F2N2O2/c17-12-7-4-8-13(18)14(12)16(22)20-10-9-19-15(21)11-5-2-1-3-6-11/h1-2,4,7-8,11H,3,5-6,9-10H2,(H,19,21)(H,20,22)/t11-/m1/s1 |
| InChIKey | ZJODVVZFWZAYKH-LLVKDONJSA-N |
| XLogP | 2.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|