C17H24N2O3 — CID 97240363
(1S)-N-[2-(3,5-dimethoxyanilino)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 97240363) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1S)-N-[2-(3,5-dimethoxyanilino)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[2-(3,5-dimethoxyanilino)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 97240363 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (1S)-N-[2-(3,5-dimethoxyanilino)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | COc1cc(NCCNC(=O)[C@@H]2CC=CCC2)cc(OC)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-21-15-10-14(11-16(12-15)22-2)18-8-9-19-17(20)13-6-4-3-5-7-13/h3-4,10-13,18H,5-9H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | HGKYDSHXFKDGIH-CYBMUJFWSA-N |
| XLogP | 2.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|