C17H23NO3 — CID 94484941
(1S)-N-[2-(2,5-dimethoxyphenyl)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 94484941) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (1S)-N-[2-(2,5-dimethoxyphenyl)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[2-(2,5-dimethoxyphenyl)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 94484941 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (1S)-N-[2-(2,5-dimethoxyphenyl)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)[C@@H]2CC=CCC2)c1 |
| InChI | InChI=1S/C17H23NO3/c1-20-15-8-9-16(21-2)14(12-15)10-11-18-17(19)13-6-4-3-5-7-13/h3-4,8-9,12-13H,5-7,10-11H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | GPOQVMSUNIGJJN-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|