C15H19NO3 — CID 51469355
(1R)-N-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxamide (PubChem CID 51469355) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (1R)-N-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 51469355 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (1R)-N-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2CC=CCC2)c(OC)c1 |
| InChI | InChI=1S/C15H19NO3/c1-18-12-8-9-13(14(10-12)19-2)16-15(17)11-6-4-3-5-7-11/h3-4,8-11H,5-7H2,1-2H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | JXNNRVCIDKYRKQ-NSHDSACASA-N |
| XLogP | 3.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|