C16H19NO3 — CID 42941653
methyl 4-(cyclohex-3-ene-1-carbonylamino)-3-methylbenzoate (PubChem CID 42941653) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 4-(cyclohex-3-ene-1-carbonylamino)-3-methylbenzoate.
| Compound Name | methyl 4-(cyclohex-3-ene-1-carbonylamino)-3-methylbenzoate |
|---|---|
| PubChem CID | 42941653 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl 4-(cyclohex-3-ene-1-carbonylamino)-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CC=CCC2)c(C)c1 |
| InChI | InChI=1S/C16H19NO3/c1-11-10-13(16(19)20-2)8-9-14(11)17-15(18)12-6-4-3-5-7-12/h3-4,8-10,12H,5-7H2,1-2H3,(H,17,18) |
| InChIKey | QHPUTCWSMUOGSW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|