C15H18N2O4 — CID 112729169
methyl 3-methyl-4-[(6-oxopiperidine-3-carbonyl)amino]benzoate (PubChem CID 112729169) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 3-methyl-4-[(6-oxopiperidine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 3-methyl-4-[(6-oxopiperidine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 112729169 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 3-methyl-4-[(6-oxopiperidine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCC(=O)NC2)c(C)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-9-7-10(15(20)21-2)3-5-12(9)17-14(19)11-4-6-13(18)16-8-11/h3,5,7,11H,4,6,8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | HKBYPSYYWHFGIZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |