C18H22N2O2 — CID 94007148
3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-N-cyclopropyl-4-methylbenzamide (PubChem CID 94007148) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-N-cyclopropyl-4-methylbenzamide.
| Compound Name | 3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-N-cyclopropyl-4-methylbenzamide |
|---|---|
| PubChem CID | 94007148 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-N-cyclopropyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1NC(=O)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C18H22N2O2/c1-12-7-8-14(18(22)19-15-9-10-15)11-16(12)20-17(21)13-5-3-2-4-6-13/h2-3,7-8,11,13,15H,4-6,9-10H2,1H3,(H,19,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | HNXZKKMFCCNHJN-ZDUSSCGKSA-N |
| XLogP | 3.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|