C15H20BrNO2 — CID 110788021
N-[2-(5-bromo-2-methoxyphenyl)ethyl]cyclopentanecarboxamide (PubChem CID 110788021) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is N-[2-(5-bromo-2-methoxyphenyl)ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(5-bromo-2-methoxyphenyl)ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110788021 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[2-(5-bromo-2-methoxyphenyl)ethyl]cyclopentanecarboxamide |
| SMILES | COc1ccc(Br)cc1CCNC(=O)C1CCCC1 |
| InChI | InChI=1S/C15H20BrNO2/c1-19-14-7-6-13(16)10-12(14)8-9-17-15(18)11-4-2-3-5-11/h6-7,10-11H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | AIOYZXHXVHGAQS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |