C16H21BrN2O3 — CID 52512867
(3R)-1-acetyl-N-[(5-bromo-2-methoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 52512867) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is (3R)-1-acetyl-N-[(5-bromo-2-methoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-acetyl-N-[(5-bromo-2-methoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 52512867 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (3R)-1-acetyl-N-[(5-bromo-2-methoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)[C@@H]1CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C16H21BrN2O3/c1-11(20)19-7-3-4-12(10-19)16(21)18-9-13-8-14(17)5-6-15(13)22-2/h5-6,8,12H,3-4,7,9-10H2,1-2H3,(H,18,21)/t12-/m1/s1 |
| InChIKey | CPLPRMXHSGXAQA-GFCCVEGCSA-N |
| XLogP | 2.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |