C20H29BrN2O2 — CID 1293873
azepan-1-yl-[(3S)-1-[(5-bromo-2-methoxyphenyl)methyl]piperidin-3-yl]methanone (PubChem CID 1293873) has the molecular formula C20H29BrN2O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is azepan-1-yl-[(3S)-1-[(5-bromo-2-methoxyphenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | azepan-1-yl-[(3S)-1-[(5-bromo-2-methoxyphenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 1293873 |
| Molecular Formula | C20H29BrN2O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | azepan-1-yl-[(3S)-1-[(5-bromo-2-methoxyphenyl)methyl]piperidin-3-yl]methanone |
| SMILES | COc1ccc(Br)cc1CN1CCC[C@H](C(=O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C20H29BrN2O2/c1-25-19-9-8-18(21)13-17(19)15-22-10-6-7-16(14-22)20(24)23-11-4-2-3-5-12-23/h8-9,13,16H,2-7,10-12,14-15H2,1H3/t16-/m0/s1 |
| InChIKey | IXIFGHGIRITVND-INIZCTEOSA-N |
| XLogP | 4.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |