C15H18FNO — CID 39911564
(1R)-N-[2-(2-fluorophenyl)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 39911564) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is (1R)-N-[2-(2-fluorophenyl)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[2-(2-fluorophenyl)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 39911564 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (1R)-N-[2-(2-fluorophenyl)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C15H18FNO/c16-14-9-5-4-6-12(14)10-11-17-15(18)13-7-2-1-3-8-13/h1-2,4-6,9,13H,3,7-8,10-11H2,(H,17,18)/t13-/m0/s1 |
| InChIKey | KNNBRCSZICAAGB-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|