C16H15F2N3O2 — CID 122569155
N-[[5-(2,6-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 122569155) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is N-[[5-(2,6-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[[5-(2,6-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 122569155 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[[5-(2,6-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCc1noc(-c2c(F)cccc2F)n1)C1CC=CCC1 |
| InChI | InChI=1S/C16H15F2N3O2/c17-11-7-4-8-12(18)14(11)16-20-13(21-23-16)9-19-15(22)10-5-2-1-3-6-10/h1-2,4,7-8,10H,3,5-6,9H2,(H,19,22) |
| InChIKey | QGYQVXSEIZUFAA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|