C8H11ClN2O3S — CID 43470811
3-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide (PubChem CID 43470811) has the molecular formula C8H11ClN2O3S and a molecular weight of 250.71 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide.
| Compound Name | 3-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 43470811 |
| Molecular Formula | C8H11ClN2O3S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 3-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide |
| SMILES | O=C(CCCl)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C8H11ClN2O3S/c9-2-1-6(12)10-3-4-11-7(13)5-15-8(11)14/h1-5H2,(H,10,12) |
| InChIKey | JFCUREJVCRRICC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|