C17H15F5N2O5S — CID 139516995
(2,3,4,5,6-pentafluorophenyl) 6-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-6-oxohexanoate (PubChem CID 139516995) has the molecular formula C17H15F5N2O5S and a molecular weight of 454.37 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 6-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-6-oxohexanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 6-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 139516995 |
| Molecular Formula | C17H15F5N2O5S |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 6-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-6-oxohexanoate |
| SMILES | O=C(CCCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C17H15F5N2O5S/c18-11-12(19)14(21)16(15(22)13(11)20)29-10(27)4-2-1-3-8(25)23-5-6-24-9(26)7-30-17(24)28/h1-7H2,(H,23,25) |
| InChIKey | FHKMMHPBIVDWEC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|