C19H32N6O2 — CID 136858396
(3S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide (PubChem CID 136858396) has the molecular formula C19H32N6O2 and a molecular weight of 376.51 g/mol. Its IUPAC name is (3S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 136858396 |
| Molecular Formula | C19H32N6O2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (3S)-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(NCCNC(=O)[C@H]2CCCN(C3CCN(C)CC3)C2)n1 |
| InChI | InChI=1S/C19H32N6O2/c1-14-12-17(26)23-19(22-14)21-8-7-20-18(27)15-4-3-9-25(13-15)16-5-10-24(2)11-6-16/h12,15-16H,3-11,13H2,1-2H3,(H,20,27)(H2,21,22,23,26)/t15-/m0/s1 |
| InChIKey | YMEGYRGCVIUYBD-HNNXBMFYSA-N |
| XLogP | 0.41 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|