C17H24N4O3S — CID 126437362
(3S)-N-[2-(2-methylindol-1-yl)ethyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide (PubChem CID 126437362) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is (3S)-N-[2-(2-methylindol-1-yl)ethyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-[2-(2-methylindol-1-yl)ethyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126437362 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3S)-N-[2-(2-methylindol-1-yl)ethyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
| SMILES | Cc1cc2ccccc2n1CCNC(=O)N1CC[C@H](CS(N)(=O)=O)C1 |
| InChI | InChI=1S/C17H24N4O3S/c1-13-10-15-4-2-3-5-16(15)21(13)9-7-19-17(22)20-8-6-14(11-20)12-25(18,23)24/h2-5,10,14H,6-9,11-12H2,1H3,(H,19,22)(H2,18,23,24)/t14-/m0/s1 |
| InChIKey | ZDDBHWUSSDFAPG-AWEZNQCLSA-N |
| XLogP | 1.27 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |