C14H16N2O3S2 — CID 125154744
[(3S)-1-(1-benzothiophene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 125154744) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is [(3S)-1-(1-benzothiophene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [(3S)-1-(1-benzothiophene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 125154744 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [(3S)-1-(1-benzothiophene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)C[C@H]1CCN(C(=O)c2cc3ccccc3s2)C1 |
| InChI | InChI=1S/C14H16N2O3S2/c15-21(18,19)9-10-5-6-16(8-10)14(17)13-7-11-3-1-2-4-12(11)20-13/h1-4,7,10H,5-6,8-9H2,(H2,15,18,19)/t10-/m0/s1 |
| InChIKey | AQQOFDPXAKNOSV-JTQLQIEISA-N |
| XLogP | 1.65 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |