C21H21NO3S2 — CID 119105549
1-benzothiophen-2-yl-(4-benzylsulfonylpiperidin-1-yl)methanone (PubChem CID 119105549) has the molecular formula C21H21NO3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-(4-benzylsulfonylpiperidin-1-yl)methanone.
| Compound Name | 1-benzothiophen-2-yl-(4-benzylsulfonylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 119105549 |
| Molecular Formula | C21H21NO3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-benzothiophen-2-yl-(4-benzylsulfonylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cc2ccccc2s1)N1CCC(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H21NO3S2/c23-21(20-14-17-8-4-5-9-19(17)26-20)22-12-10-18(11-13-22)27(24,25)15-16-6-2-1-3-7-16/h1-9,14,18H,10-13,15H2 |
| InChIKey | DMXLUCPPUPILGP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |