C20H19NOS2 — CID 99884152
1-benzothiophen-2-yl-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone (PubChem CID 99884152) has the molecular formula C20H19NOS2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 99884152 |
| Molecular Formula | C20H19NOS2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-benzothiophen-2-yl-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone |
| SMILES | O=C(c1cc2ccccc2s1)N1CCS[C@@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C20H19NOS2/c22-20(19-14-16-8-4-5-9-18(16)24-19)21-11-10-17(23-13-12-21)15-6-2-1-3-7-15/h1-9,14,17H,10-13H2/t17-/m1/s1 |
| InChIKey | CFQPAWLMEALLBC-QGZVFWFLSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |