C16H16BrNOS2 — CID 99884159
(4-bromothiophen-2-yl)-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone (PubChem CID 99884159) has the molecular formula C16H16BrNOS2 and a molecular weight of 382.35 g/mol. Its IUPAC name is (4-bromothiophen-2-yl)-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone.
| Compound Name | (4-bromothiophen-2-yl)-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 99884159 |
| Molecular Formula | C16H16BrNOS2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | (4-bromothiophen-2-yl)-[(7R)-7-phenyl-1,4-thiazepan-4-yl]methanone |
| SMILES | O=C(c1cc(Br)cs1)N1CCS[C@@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C16H16BrNOS2/c17-13-10-15(21-11-13)16(19)18-7-6-14(20-9-8-18)12-4-2-1-3-5-12/h1-5,10-11,14H,6-9H2/t14-/m1/s1 |
| InChIKey | FIIWRZTXAVOLAU-CQSZACIVSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |