C20H20N2OS — CID 73169009
1H-indol-3-yl-(7-phenyl-1,4-thiazepan-4-yl)methanone (PubChem CID 73169009) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 1H-indol-3-yl-(7-phenyl-1,4-thiazepan-4-yl)methanone.
| Compound Name | 1H-indol-3-yl-(7-phenyl-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 73169009 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1H-indol-3-yl-(7-phenyl-1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N2OS/c23-20(17-14-21-18-9-5-4-8-16(17)18)22-11-10-19(24-13-12-22)15-6-2-1-3-7-15/h1-9,14,19,21H,10-13H2 |
| InChIKey | UCLIZARLNJFOSE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |