C13H16ClNOS — CID 90629357
2-chloro-1-(7-phenyl-1,4-thiazepan-4-yl)ethanone (PubChem CID 90629357) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-chloro-1-(7-phenyl-1,4-thiazepan-4-yl)ethanone.
| Compound Name | 2-chloro-1-(7-phenyl-1,4-thiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 90629357 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-chloro-1-(7-phenyl-1,4-thiazepan-4-yl)ethanone |
| SMILES | O=C(CCl)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C13H16ClNOS/c14-10-13(16)15-7-6-12(17-9-8-15)11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | WPYJIZHCQPIKNA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|