C19H19Cl2NO2S — CID 99903808
2-(2,4-dichlorophenoxy)-1-[(7R)-7-phenyl-1,4-thiazepan-4-yl]ethanone (PubChem CID 99903808) has the molecular formula C19H19Cl2NO2S and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[(7R)-7-phenyl-1,4-thiazepan-4-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[(7R)-7-phenyl-1,4-thiazepan-4-yl]ethanone |
|---|---|
| PubChem CID | 99903808 |
| Molecular Formula | C19H19Cl2NO2S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[(7R)-7-phenyl-1,4-thiazepan-4-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCS[C@@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19Cl2NO2S/c20-15-6-7-17(16(21)12-15)24-13-19(23)22-9-8-18(25-11-10-22)14-4-2-1-3-5-14/h1-7,12,18H,8-11,13H2/t18-/m1/s1 |
| InChIKey | KRKQEKWTHVXWIK-GOSISDBHSA-N |
| XLogP | 5.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |