C16H19N3OS — CID 90629468
1-(7-phenyl-1,4-thiazepan-4-yl)-2-pyrazol-1-ylethanone (PubChem CID 90629468) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-(7-phenyl-1,4-thiazepan-4-yl)-2-pyrazol-1-ylethanone.
| Compound Name | 1-(7-phenyl-1,4-thiazepan-4-yl)-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 90629468 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-(7-phenyl-1,4-thiazepan-4-yl)-2-pyrazol-1-ylethanone |
| SMILES | O=C(Cn1cccn1)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(13-19-9-4-8-17-19)18-10-7-15(21-12-11-18)14-5-2-1-3-6-14/h1-6,8-9,15H,7,10-13H2 |
| InChIKey | CRNYDAIEVGBTGE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |