C16H21NOS — CID 73169000
1-(7-phenyl-1,4-thiazepan-4-yl)pent-4-en-1-one (PubChem CID 73169000) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-(7-phenyl-1,4-thiazepan-4-yl)pent-4-en-1-one.
| Compound Name | 1-(7-phenyl-1,4-thiazepan-4-yl)pent-4-en-1-one |
|---|---|
| PubChem CID | 73169000 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(7-phenyl-1,4-thiazepan-4-yl)pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H21NOS/c1-2-3-9-16(18)17-11-10-15(19-13-12-17)14-7-5-4-6-8-14/h2,4-8,15H,1,3,9-13H2 |
| InChIKey | GZBXWUITUAPOGT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|