C21H23NO2S — CID 124670829
1-phenyl-4-[(7S)-7-phenyl-1,4-thiazepan-4-yl]butane-1,4-dione (PubChem CID 124670829) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-phenyl-4-[(7S)-7-phenyl-1,4-thiazepan-4-yl]butane-1,4-dione.
| Compound Name | 1-phenyl-4-[(7S)-7-phenyl-1,4-thiazepan-4-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 124670829 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-phenyl-4-[(7S)-7-phenyl-1,4-thiazepan-4-yl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCS[C@H](c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2S/c23-19(17-7-3-1-4-8-17)11-12-21(24)22-14-13-20(25-16-15-22)18-9-5-2-6-10-18/h1-10,20H,11-16H2/t20-/m0/s1 |
| InChIKey | OWRQZZGMROFLNI-FQEVSTJZSA-N |
| XLogP | 4.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |