C22H25NO2S — CID 90631072
1-[7-(2-methylphenyl)-1,4-thiazepan-4-yl]-4-phenylbutane-1,4-dione (PubChem CID 90631072) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 1-[7-(2-methylphenyl)-1,4-thiazepan-4-yl]-4-phenylbutane-1,4-dione.
| Compound Name | 1-[7-(2-methylphenyl)-1,4-thiazepan-4-yl]-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 90631072 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[7-(2-methylphenyl)-1,4-thiazepan-4-yl]-4-phenylbutane-1,4-dione |
| SMILES | Cc1ccccc1C1CCN(C(=O)CCC(=O)c2ccccc2)CCS1 |
| InChI | InChI=1S/C22H25NO2S/c1-17-7-5-6-10-19(17)21-13-14-23(15-16-26-21)22(25)12-11-20(24)18-8-3-2-4-9-18/h2-10,21H,11-16H2,1H3 |
| InChIKey | SXZVSSYZMNXFMA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |