C21H30N4O3 — CID 119067242
3-(2,3-dimethoxyphenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrrolidine-1-carboxamide (PubChem CID 119067242) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(2,3-dimethoxyphenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 119067242 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrrolidine-1-carboxamide |
| SMILES | COc1cccc(C2CCN(C(=O)NCCCn3nc(C)cc3C)C2)c1OC |
| InChI | InChI=1S/C21H30N4O3/c1-15-13-16(2)25(23-15)11-6-10-22-21(26)24-12-9-17(14-24)18-7-5-8-19(27-3)20(18)28-4/h5,7-8,13,17H,6,9-12,14H2,1-4H3,(H,22,26) |
| InChIKey | CDLLKZFCRJUZKY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|