C24H38IN5O2 — CID 111564210
2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide (PubChem CID 111564210) has the molecular formula C24H38IN5O2 and a molecular weight of 555.51 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111564210 |
| Molecular Formula | C24H38IN5O2 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC1CCCC1)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C24H37N5O2.HI/c1-5-25-24(26-14-9-15-29-19(3)16-18(2)28-29)27-17-20-10-8-13-22(30-4)23(20)31-21-11-6-7-12-21;/h8,10,13,16,21H,5-7,9,11-12,14-15,17H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | KKEKZXOXIMWKQB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|