C21H37IN4O4S — CID 111564844
2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide (PubChem CID 111564844) has the molecular formula C21H37IN4O4S and a molecular weight of 568.52 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111564844 |
| Molecular Formula | C21H37IN4O4S |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC1CCCC1)NCCCNS(=O)(=O)CC.I |
| InChI | InChI=1S/C21H36N4O4S.HI/c1-4-22-21(23-14-9-15-25-30(26,27)5-2)24-16-17-10-8-13-19(28-3)20(17)29-18-11-6-7-12-18;/h8,10,13,18,25H,4-7,9,11-12,14-16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | FPFBHQLLZFVWDX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|