C16H24Cl2N6S — CID 19573251
1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea (PubChem CID 19573251) has the molecular formula C16H24Cl2N6S and a molecular weight of 403.38 g/mol. Its IUPAC name is 1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19573251 |
| Molecular Formula | C16H24Cl2N6S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiourea |
| SMILES | Cc1cc(C)n(CCCNC(=S)NCCCn2nc(C)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C16H24Cl2N6S/c1-11-10-12(2)23(21-11)8-4-6-19-16(25)20-7-5-9-24-15(18)14(17)13(3)22-24/h10H,4-9H2,1-3H3,(H2,19,20,25) |
| InChIKey | YKEZALBQSVEKFV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|