C14H22N6OS — CID 19445663
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea (PubChem CID 19445663) has the molecular formula C14H22N6OS and a molecular weight of 322.44 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445663 |
| Molecular Formula | C14H22N6OS |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea |
| SMILES | COCn1cc(NC(=S)NCCCn2nc(C)cc2C)cn1 |
| InChI | InChI=1S/C14H22N6OS/c1-11-7-12(2)20(18-11)6-4-5-15-14(22)17-13-8-16-19(9-13)10-21-3/h7-9H,4-6,10H2,1-3H3,(H2,15,17,22) |
| InChIKey | WISWOSXWRRWNIW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|