C18H29N7S — CID 19291556
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide (PubChem CID 19291556) has the molecular formula C18H29N7S and a molecular weight of 375.55 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291556 |
| Molecular Formula | C18H29N7S |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)n(CCCNC(=S)N2CCN(Cc3cnn(C)c3)CC2)n1 |
| InChI | InChI=1S/C18H29N7S/c1-15-11-16(2)25(21-15)6-4-5-19-18(26)24-9-7-23(8-10-24)14-17-12-20-22(3)13-17/h11-13H,4-10,14H2,1-3H3,(H,19,26) |
| InChIKey | YVLMIBYDPQRHQT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|