C11H18Cl2N4S — CID 19573221
1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-propylthiourea (PubChem CID 19573221) has the molecular formula C11H18Cl2N4S and a molecular weight of 309.27 g/mol. Its IUPAC name is 1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-propylthiourea.
| Compound Name | 1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-propylthiourea |
|---|---|
| PubChem CID | 19573221 |
| Molecular Formula | C11H18Cl2N4S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NCCCn1nc(C)c(Cl)c1Cl |
| InChI | InChI=1S/C11H18Cl2N4S/c1-3-5-14-11(18)15-6-4-7-17-10(13)9(12)8(2)16-17/h3-7H2,1-2H3,(H2,14,15,18) |
| InChIKey | IUTPDQWTRJQEEE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|