C13H23ClN4OS — CID 4768528
1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-(3-methoxypropyl)thiourea (PubChem CID 4768528) has the molecular formula C13H23ClN4OS and a molecular weight of 318.87 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 4768528 |
| Molecular Formula | C13H23ClN4OS |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NCCCn1nc(C)c(Cl)c1C |
| InChI | InChI=1S/C13H23ClN4OS/c1-10-12(14)11(2)18(17-10)8-4-6-15-13(20)16-7-5-9-19-3/h4-9H2,1-3H3,(H2,15,16,20) |
| InChIKey | PYINWWLVQNTRSC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|