C18H19Cl2N5O — CID 19513158
N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(4-methylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19513158) has the molecular formula C18H19Cl2N5O and a molecular weight of 392.29 g/mol. Its IUPAC name is N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(4-methylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(4-methylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19513158 |
| Molecular Formula | C18H19Cl2N5O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(4-methylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCCn3nc(C)c(Cl)c3Cl)[nH]n2)cc1 |
| InChI | InChI=1S/C18H19Cl2N5O/c1-11-4-6-13(7-5-11)14-10-15(23-22-14)18(26)21-8-3-9-25-17(20)16(19)12(2)24-25/h4-7,10H,3,8-9H2,1-2H3,(H,21,26)(H,22,23) |
| InChIKey | LSRWYRTVUWTDPF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|