C18H17Cl2N5O3 — CID 19513466
3-(1,3-benzodioxol-5-yl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide (PubChem CID 19513466) has the molecular formula C18H17Cl2N5O3 and a molecular weight of 422.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19513466 |
| Molecular Formula | C18H17Cl2N5O3 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2cc(-c3ccc4c(c3)OCO4)n[nH]2)c(Cl)c1Cl |
| InChI | InChI=1S/C18H17Cl2N5O3/c1-10-16(19)17(20)25(24-10)6-2-5-21-18(26)13-8-12(22-23-13)11-3-4-14-15(7-11)28-9-27-14/h3-4,7-8H,2,5-6,9H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | UZLCPQFDZGIMGK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|