C17H16Cl3N5O — CID 19509582
3-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide (PubChem CID 19509582) has the molecular formula C17H16Cl3N5O and a molecular weight of 412.71 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19509582 |
| Molecular Formula | C17H16Cl3N5O |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2cc(-c3ccc(Cl)cc3)n[nH]2)c(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl3N5O/c1-10-15(19)16(20)25(24-10)8-2-7-21-17(26)14-9-13(22-23-14)11-3-5-12(18)6-4-11/h3-6,9H,2,7-8H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | LDFSQAWAJUBMRQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|