C17H21Cl2N3O4 — CID 19332159
N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-2,3,4-trimethoxybenzamide (PubChem CID 19332159) has the molecular formula C17H21Cl2N3O4 and a molecular weight of 402.28 g/mol. Its IUPAC name is N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 19332159 |
| Molecular Formula | C17H21Cl2N3O4 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCn2nc(C)c(Cl)c2Cl)c(OC)c1OC |
| InChI | InChI=1S/C17H21Cl2N3O4/c1-10-13(18)16(19)22(21-10)9-5-8-20-17(23)11-6-7-12(24-2)15(26-4)14(11)25-3/h6-7H,5,8-9H2,1-4H3,(H,20,23) |
| InChIKey | GMKOCORYMBDPNQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|