C17H24N4O4 — CID 91785507
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,3,4-trimethoxybenzamide (PubChem CID 91785507) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 91785507 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCn2nc(C)nc2C)c(OC)c1OC |
| InChI | InChI=1S/C17H24N4O4/c1-11-19-12(2)21(20-11)10-6-9-18-17(22)13-7-8-14(23-3)16(25-5)15(13)24-4/h7-8H,6,9-10H2,1-5H3,(H,18,22) |
| InChIKey | SLSJJYUMQOWLJJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|