C12H20Cl2N4O — CID 19334062
1-butyl-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]urea (PubChem CID 19334062) has the molecular formula C12H20Cl2N4O and a molecular weight of 307.23 g/mol. Its IUPAC name is 1-butyl-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]urea.
| Compound Name | 1-butyl-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 19334062 |
| Molecular Formula | C12H20Cl2N4O |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-butyl-3-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]urea |
| SMILES | CCCCNC(=O)NCCCn1nc(C)c(Cl)c1Cl |
| InChI | InChI=1S/C12H20Cl2N4O/c1-3-4-6-15-12(19)16-7-5-8-18-11(14)10(13)9(2)17-18/h3-8H2,1-2H3,(H2,15,16,19) |
| InChIKey | LNYCUOSEWPWUGB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|