C17H18Cl3N3O — CID 19332081
2-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 19332081) has the molecular formula C17H18Cl3N3O and a molecular weight of 386.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 19332081 |
| Molecular Formula | C17H18Cl3N3O |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)C2CC2c2ccc(Cl)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C17H18Cl3N3O/c1-10-15(19)16(20)23(22-10)8-2-7-21-17(24)14-9-13(14)11-3-5-12(18)6-4-11/h3-6,13-14H,2,7-9H2,1H3,(H,21,24) |
| InChIKey | ITKWHVOUWPKHDF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|