C16H17ClN2O2 — CID 95307240
trans-(1S,2S)-2-(4-chlorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]cyclopropane-1-carboxamide (PubChem CID 95307240) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-chlorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(4-chlorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95307240 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | trans-(1S,2S)-2-(4-chlorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]cyclopropane-1-carboxamide |
| SMILES | C#CCNC(=O)CCNC(=O)[C@H]1C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-2-8-18-15(20)7-9-19-16(21)14-10-13(14)11-3-5-12(17)6-4-11/h1,3-6,13-14H,7-10H2,(H,18,20)(H,19,21)/t13-,14+/m1/s1 |
| InChIKey | VUGCHINDAWHYPL-KGLIPLIRSA-N |
| XLogP | 1.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|