C16H16ClFN4O — CID 124842520
trans-(1S,2S)-2-(4-chlorophenyl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 124842520) has the molecular formula C16H16ClFN4O and a molecular weight of 334.78 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-chlorophenyl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(4-chlorophenyl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 124842520 |
| Molecular Formula | C16H16ClFN4O |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | trans-(1S,2S)-2-(4-chlorophenyl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | Cc1nn(C)c(F)c1/C=N\NC(=O)[C@H]1C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClFN4O/c1-9-14(15(18)22(2)21-9)8-19-20-16(23)13-7-12(13)10-3-5-11(17)6-4-10/h3-6,8,12-13H,7H2,1-2H3,(H,20,23)/b19-8-/t12-,13+/m1/s1 |
| InChIKey | CHSWUIWJUISIQD-SCUOVIJBSA-N |
| XLogP | 2.77 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|