C13H20FN5O3S — CID 171130965
N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 171130965) has the molecular formula C13H20FN5O3S and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 171130965 |
| Molecular Formula | C13H20FN5O3S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C=NNC(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H20FN5O3S/c1-9-11(12(14)18(2)17-9)8-15-16-13(20)10-4-6-19(7-5-10)23(3,21)22/h8,10H,4-7H2,1-3H3,(H,16,20) |
| InChIKey | MVUNVTMUUHAFNF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|