C14H18ClFN6O — CID 119055887
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide (PubChem CID 119055887) has the molecular formula C14H18ClFN6O and a molecular weight of 340.79 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide.
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 119055887 |
| Molecular Formula | C14H18ClFN6O |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide |
| SMILES | Cc1nn(CCC(=O)N/N=C/c2c(C)nn(C)c2F)c(C)c1Cl |
| InChI | InChI=1S/C14H18ClFN6O/c1-8-11(14(16)21(4)19-8)7-17-18-12(23)5-6-22-10(3)13(15)9(2)20-22/h7H,5-6H2,1-4H3,(H,18,23)/b17-7+ |
| InChIKey | QCCXRJVMNMLSRB-REZTVBANSA-N |
| XLogP | 1.87 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|