C12H14ClFN6O — CID 171130907
4-chloro-1-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 171130907) has the molecular formula C12H14ClFN6O and a molecular weight of 312.74 g/mol. Its IUPAC name is 4-chloro-1-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171130907 |
| Molecular Formula | C12H14ClFN6O |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-chloro-1-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Cl)c(C(=O)NN=Cc2c(C)nn(C)c2F)n1 |
| InChI | InChI=1S/C12H14ClFN6O/c1-4-20-6-9(13)10(18-20)12(21)16-15-5-8-7(2)17-19(3)11(8)14/h5-6H,4H2,1-3H3,(H,16,21) |
| InChIKey | CNFSEYSKTNPUAZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|