C17H20FN7O — CID 119055927
1-ethyl-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 119055927) has the molecular formula C17H20FN7O and a molecular weight of 357.39 g/mol. Its IUPAC name is 1-ethyl-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 1-ethyl-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119055927 |
| Molecular Formula | C17H20FN7O |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-ethyl-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCn1nc(C)c2c(C(=O)N/N=C/c3c(C)nn(C)c3F)cc(C)nc21 |
| InChI | InChI=1S/C17H20FN7O/c1-6-25-16-14(11(4)23-25)12(7-9(2)20-16)17(26)21-19-8-13-10(3)22-24(5)15(13)18/h7-8H,6H2,1-5H3,(H,21,26)/b19-8+ |
| InChIKey | JFWWCJJBFVPKTE-UFWORHAWSA-N |
| XLogP | 2.01 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|